C7H12O2 — CID 10630502
(1S)-1-[(2S)-3,3-dimethyloxiran-2-yl]prop-2-en-1-ol (PubChem CID 10630502) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (1S)-1-[(2S)-3,3-dimethyloxiran-2-yl]prop-2-en-1-ol.
| Compound Name | (1S)-1-[(2S)-3,3-dimethyloxiran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 10630502 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (1S)-1-[(2S)-3,3-dimethyloxiran-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H](O)[C@@H]1OC1(C)C |
| InChI | InChI=1S/C7H12O2/c1-4-5(8)6-7(2,3)9-6/h4-6,8H,1H2,2-3H3/t5-,6-/m0/s1 |
| InChIKey | WHFKRMYBJNFGQE-WDSKDSINSA-N |
| XLogP | 0.71 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|