C10H15NO3S — CID 106305059
1-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylpyrrole-2,5-dione (PubChem CID 106305059) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 106305059 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCSCCCO)C1=O |
| InChI | InChI=1S/C10H15NO3S/c1-8-7-9(13)11(10(8)14)3-6-15-5-2-4-12/h7,12H,2-6H2,1H3 |
| InChIKey | UOJXNHQMKCYOOW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|