C9H18N2O2S — CID 106305088
1-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-diazinan-2-one (PubChem CID 106305088) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 106305088 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CCSCCCO |
| InChI | InChI=1S/C9H18N2O2S/c12-6-2-7-14-8-5-11-4-1-3-10-9(11)13/h12H,1-8H2,(H,10,13) |
| InChIKey | MNNPLXIQLXERRP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|