C13H20N2O4 — CID 106305378
2-ethyl-6-[3-(2-hydroxyethoxy)propylamino]pyridine-4-carboxylic acid (PubChem CID 106305378) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-ethyl-6-[3-(2-hydroxyethoxy)propylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-ethyl-6-[3-(2-hydroxyethoxy)propylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106305378 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-ethyl-6-[3-(2-hydroxyethoxy)propylamino]pyridine-4-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc(NCCCOCCO)n1 |
| InChI | InChI=1S/C13H20N2O4/c1-2-11-8-10(13(17)18)9-12(15-11)14-4-3-6-19-7-5-16/h8-9,16H,2-7H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | HQBBCSPWTHXXGO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|