About 2-methoxy-7-methyl-1H-1,3-diazepine
2-methoxy-7-methyl-1H-1,3-diazepine (PubChem CID 10630559) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methoxy-7-methyl-1H-1,3-diazepine.
Molecular Properties
| Compound Name | 2-methoxy-7-methyl-1H-1,3-diazepine |
| PubChem CID | 10630559 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2-methoxy-7-methyl-1H-1,3-diazepine |
| SMILES | COC1=NC=CC=C(C)N1 |
| InChI | InChI=1S/C7H10N2O/c1-6-4-3-5-8-7(9-6)10-2/h3-5H,1-2H3,(H,8,9) |
| InChIKey | QMNZIHKMPVWGIZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-7-methyl-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-7-methyl-1H-1,3-diazepine?
The IUPAC name of 2-methoxy-7-methyl-1H-1,3-diazepine (CID 10630559) is 2-methoxy-7-methyl-1H-1,3-diazepine.
What is the SMILES notation for 2-methoxy-7-methyl-1H-1,3-diazepine?
The canonical SMILES for 2-methoxy-7-methyl-1H-1,3-diazepine is COC1=NC=CC=C(C)N1.
What is the InChIKey of 2-methoxy-7-methyl-1H-1,3-diazepine?
The InChIKey is QMNZIHKMPVWGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-6-4-3-5-8-7(9-6)10-2/h3-5H,1-2H3,(H,8,9).
What are the key properties of 2-methoxy-7-methyl-1H-1,3-diazepine?
2-methoxy-7-methyl-1H-1,3-diazepine has a molecular weight of 138.17 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-7-methyl-1H-1,3-diazepine is sourced from PubChem (CID 10630559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).