C4H4N2O4 — CID 10630648
5-hydroxy-(2,4-13C2,1,3-14N2)1,3-diazinane-2,4,6-trione (PubChem CID 10630648) has the molecular formula C4H4N2O4 and a molecular weight of 146.06 g/mol. Its IUPAC name is 5-hydroxy-(2,4-13C2,1,3-14N2)1,3-diazinane-2,4,6-trione.
| Compound Name | 5-hydroxy-(2,4-13C2,1,3-14N2)1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10630648 |
| Molecular Formula | C4H4N2O4 |
| Molecular Weight | 146.06 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 5-hydroxy-(2,4-13C2,1,3-14N2)1,3-diazinane-2,4,6-trione |
| SMILES | O=C1[14NH][13C](=O)[14NH][13C](=O)C1O |
| InChI | InChI=1S/C4H4N2O4/c7-1-2(8)5-4(10)6-3(1)9/h1,7H,(H2,5,6,8,9,10)/i2+1,4+1,5+0,6+0 |
| InChIKey | BVEWMNTVZPFPQI-FOSHHHTMSA-N |
| XLogP | -2.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.06 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|