About 3-formylbenzamide
3-formylbenzamide (PubChem CID 10630670) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-formylbenzamide.
Molecular Properties
| Compound Name | 3-formylbenzamide |
| PubChem CID | 10630670 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 3-formylbenzamide |
| SMILES | NC(=O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C8H7NO2/c9-8(11)7-3-1-2-6(4-7)5-10/h1-5H,(H2,9,11) |
| InChIKey | AYYCJLDODRZCOB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylbenzamide?
The IUPAC name of 3-formylbenzamide (CID 10630670) is 3-formylbenzamide.
What is the SMILES notation for 3-formylbenzamide?
The canonical SMILES for 3-formylbenzamide is NC(=O)c1cccc(C=O)c1.
What is the InChIKey of 3-formylbenzamide?
The InChIKey is AYYCJLDODRZCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c9-8(11)7-3-1-2-6(4-7)5-10/h1-5H,(H2,9,11).
What are the key properties of 3-formylbenzamide?
3-formylbenzamide has a molecular weight of 149.15 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylbenzamide is sourced from PubChem (CID 10630670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).