About 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol
4-[(1E)-buta-1,3-dienoxy]pentan-2-ol (PubChem CID 10630751) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol.
Molecular Properties
| Compound Name | 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol |
| PubChem CID | 10630751 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol |
| SMILES | C=C/C=C/OC(C)CC(C)O |
| InChI | InChI=1S/C9H16O2/c1-4-5-6-11-9(3)7-8(2)10/h4-6,8-10H,1,7H2,2-3H3/b6-5+ |
| InChIKey | IKIWPOCEACGLOD-AATRIKPKSA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol?
The IUPAC name of 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol (CID 10630751) is 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol.
What is the SMILES notation for 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol?
The canonical SMILES for 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol is C=C/C=C/OC(C)CC(C)O.
What is the InChIKey of 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol?
The InChIKey is IKIWPOCEACGLOD-AATRIKPKSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-5-6-11-9(3)7-8(2)10/h4-6,8-10H,1,7H2,2-3H3/b6-5+.
What are the key properties of 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol?
4-[(1E)-buta-1,3-dienoxy]pentan-2-ol has a molecular weight of 156.22 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-buta-1,3-dienoxy]pentan-2-ol is sourced from PubChem (CID 10630751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).