About 3-chloro-1H-pyrrole-2,4-dicarbaldehyde
3-chloro-1H-pyrrole-2,4-dicarbaldehyde (PubChem CID 10630770) has the molecular formula C6H4ClNO2
and a molecular weight of 157.56 g/mol. Its IUPAC name is 3-chloro-1H-pyrrole-2,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 3-chloro-1H-pyrrole-2,4-dicarbaldehyde |
| PubChem CID | 10630770 |
| Molecular Formula | C6H4ClNO2 |
| Molecular Weight | 157.56 g/mol |
| Exact Mass | 156.99 |
| IUPAC Name | 3-chloro-1H-pyrrole-2,4-dicarbaldehyde |
| SMILES | O=Cc1c[nH]c(C=O)c1Cl |
| InChI | InChI=1S/C6H4ClNO2/c7-6-4(2-9)1-8-5(6)3-10/h1-3,8H |
| InChIKey | QHXJOPRJYSKWFU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1H-pyrrole-2,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1H-pyrrole-2,4-dicarbaldehyde?
The IUPAC name of 3-chloro-1H-pyrrole-2,4-dicarbaldehyde (CID 10630770) is 3-chloro-1H-pyrrole-2,4-dicarbaldehyde.
What is the SMILES notation for 3-chloro-1H-pyrrole-2,4-dicarbaldehyde?
The canonical SMILES for 3-chloro-1H-pyrrole-2,4-dicarbaldehyde is O=Cc1c[nH]c(C=O)c1Cl.
What is the InChIKey of 3-chloro-1H-pyrrole-2,4-dicarbaldehyde?
The InChIKey is QHXJOPRJYSKWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO2/c7-6-4(2-9)1-8-5(6)3-10/h1-3,8H.
What are the key properties of 3-chloro-1H-pyrrole-2,4-dicarbaldehyde?
3-chloro-1H-pyrrole-2,4-dicarbaldehyde has a molecular weight of 157.56 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1H-pyrrole-2,4-dicarbaldehyde is sourced from PubChem (CID 10630770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).