About (E)-dec-5-en-3,7-diyne-2,9-diol
(E)-dec-5-en-3,7-diyne-2,9-diol (PubChem CID 10630854) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is (E)-dec-5-en-3,7-diyne-2,9-diol.
Molecular Properties
| Compound Name | (E)-dec-5-en-3,7-diyne-2,9-diol |
| PubChem CID | 10630854 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (E)-dec-5-en-3,7-diyne-2,9-diol |
| SMILES | CC(O)C#C/C=C/C#CC(C)O |
| InChI | InChI=1S/C10H12O2/c1-9(11)7-5-3-4-6-8-10(2)12/h3-4,9-12H,1-2H3/b4-3+ |
| InChIKey | NBQYQAFYWHPYCA-ONEGZZNKSA-N |
| XLogP | 0.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-dec-5-en-3,7-diyne-2,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-dec-5-en-3,7-diyne-2,9-diol?
The IUPAC name of (E)-dec-5-en-3,7-diyne-2,9-diol (CID 10630854) is (E)-dec-5-en-3,7-diyne-2,9-diol.
What is the SMILES notation for (E)-dec-5-en-3,7-diyne-2,9-diol?
The canonical SMILES for (E)-dec-5-en-3,7-diyne-2,9-diol is CC(O)C#C/C=C/C#CC(C)O.
What is the InChIKey of (E)-dec-5-en-3,7-diyne-2,9-diol?
The InChIKey is NBQYQAFYWHPYCA-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H12O2/c1-9(11)7-5-3-4-6-8-10(2)12/h3-4,9-12H,1-2H3/b4-3+.
What are the key properties of (E)-dec-5-en-3,7-diyne-2,9-diol?
(E)-dec-5-en-3,7-diyne-2,9-diol has a molecular weight of 164.20 g/mol, XLogP of 0.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dec-5-en-3,7-diyne-2,9-diol is sourced from PubChem (CID 10630854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).