About 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one
8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 10631089) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 10631089 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Cc1cc(N)c2c(c1)CCCC2=O |
| InChI | InChI=1S/C11H13NO/c1-7-5-8-3-2-4-10(13)11(8)9(12)6-7/h5-6H,2-4,12H2,1H3 |
| InChIKey | NCTRHTWXZGCMAT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one (CID 10631089) is 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one is Cc1cc(N)c2c(c1)CCCC2=O.
What is the InChIKey of 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is NCTRHTWXZGCMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7-5-8-3-2-4-10(13)11(8)9(12)6-7/h5-6H,2-4,12H2,1H3.
What are the key properties of 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 175.23 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-methyl-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 10631089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).