About 2-(azidomethyl)-1,3,5-trimethylbenzene
2-(azidomethyl)-1,3,5-trimethylbenzene (PubChem CID 10631091) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(azidomethyl)-1,3,5-trimethylbenzene |
| PubChem CID | 10631091 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(azidomethyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(CN=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C10H13N3/c1-7-4-8(2)10(6-12-13-11)9(3)5-7/h4-5H,6H2,1-3H3 |
| InChIKey | QZRDSVMEBMBTKU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-1,3,5-trimethylbenzene?
The IUPAC name of 2-(azidomethyl)-1,3,5-trimethylbenzene (CID 10631091) is 2-(azidomethyl)-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(azidomethyl)-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(azidomethyl)-1,3,5-trimethylbenzene is Cc1cc(C)c(CN=[N+]=[N-])c(C)c1.
What is the InChIKey of 2-(azidomethyl)-1,3,5-trimethylbenzene?
The InChIKey is QZRDSVMEBMBTKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-7-4-8(2)10(6-12-13-11)9(3)5-7/h4-5H,6H2,1-3H3.
What are the key properties of 2-(azidomethyl)-1,3,5-trimethylbenzene?
2-(azidomethyl)-1,3,5-trimethylbenzene has a molecular weight of 175.23 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-1,3,5-trimethylbenzene is sourced from PubChem (CID 10631091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).