About 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol
2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol (PubChem CID 106311418) has the molecular formula C7H15N5O2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol.
Molecular Properties
| Compound Name | 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol |
| PubChem CID | 106311418 |
| Molecular Formula | C7H15N5O2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol |
| SMILES | Nc1nc(NCCCOCCO)n[nH]1 |
| InChI | InChI=1S/C7H15N5O2/c8-6-10-7(12-11-6)9-2-1-4-14-5-3-13/h13H,1-5H2,(H4,8,9,10,11,12) |
| InChIKey | BEOIUVULDRTYNR-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol?
The IUPAC name of 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol (CID 106311418) is 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol.
What is the SMILES notation for 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol?
The canonical SMILES for 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol is Nc1nc(NCCCOCCO)n[nH]1.
What is the InChIKey of 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol?
The InChIKey is BEOIUVULDRTYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5O2/c8-6-10-7(12-11-6)9-2-1-4-14-5-3-13/h13H,1-5H2,(H4,8,9,10,11,12).
What are the key properties of 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol?
2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol has a molecular weight of 201.23 g/mol, XLogP of -0.80, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propoxy]ethanol is sourced from PubChem (CID 106311418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).