C14H22N4OS2 — CID 106311692
3-[2-[[6-ethyl-2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311692) has the molecular formula C14H22N4OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 3-[2-[[6-ethyl-2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[[6-ethyl-2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311692 |
| Molecular Formula | C14H22N4OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[2-[[6-ethyl-2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol |
| SMILES | CCc1cc2c(NCCSCCCO)nc(NC)nc2s1 |
| InChI | InChI=1S/C14H22N4OS2/c1-3-10-9-11-12(16-5-8-20-7-4-6-19)17-14(15-2)18-13(11)21-10/h9,19H,3-8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | BPOIMUJLQOMNQL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|