C13H14N4O — CID 106312020
2-amino-N,N-bis(cyanomethyl)-2-(4-methylphenyl)acetamide (PubChem CID 106312020) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-amino-N,N-bis(cyanomethyl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-amino-N,N-bis(cyanomethyl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 106312020 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-amino-N,N-bis(cyanomethyl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)N(CC#N)CC#N)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-10-2-4-11(5-3-10)12(16)13(18)17(8-6-14)9-7-15/h2-5,12H,8-9,16H2,1H3 |
| InChIKey | DXXZWMYGULIPLP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|