C15H22N2O3 — CID 106312267
methyl 2-[[2-amino-2-(4-methylphenyl)acetyl]amino]-3-methylbutanoate (PubChem CID 106312267) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[[2-amino-2-(4-methylphenyl)acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[2-amino-2-(4-methylphenyl)acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 106312267 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | methyl 2-[[2-amino-2-(4-methylphenyl)acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)C(N)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-9(2)13(15(19)20-4)17-14(18)12(16)11-7-5-10(3)6-8-11/h5-9,12-13H,16H2,1-4H3,(H,17,18) |
| InChIKey | VZZZMHVNKKAQNH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |