About 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide
2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide (PubChem CID 106312742) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide |
| PubChem CID | 106312742 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)Nc2nnc(C)o2)cc1 |
| InChI | InChI=1S/C12H14N4O2/c1-7-3-5-9(6-4-7)10(13)11(17)14-12-16-15-8(2)18-12/h3-6,10H,13H2,1-2H3,(H,14,16,17) |
| InChIKey | PFDJWPIAEWYDDO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide?
The IUPAC name of 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide (CID 106312742) is 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide.
What is the SMILES notation for 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide?
The canonical SMILES for 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide is Cc1ccc(C(N)C(=O)Nc2nnc(C)o2)cc1.
What is the InChIKey of 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide?
The InChIKey is PFDJWPIAEWYDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-7-3-5-9(6-4-7)10(13)11(17)14-12-16-15-8(2)18-12/h3-6,10H,13H2,1-2H3,(H,14,16,17).
What are the key properties of 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide?
2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide has a molecular weight of 246.27 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(5-methyl-1,3,4-oxadiazol-2-yl)-2-(4-methylphenyl)acetamide is sourced from PubChem (CID 106312742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).