About 2-aminothieno[3,2-d][1,3]thiazin-4-one
2-aminothieno[3,2-d][1,3]thiazin-4-one (PubChem CID 10631349) has the molecular formula C6H4N2OS2
and a molecular weight of 184.25 g/mol. Its IUPAC name is 2-aminothieno[3,2-d][1,3]thiazin-4-one.
Molecular Properties
| Compound Name | 2-aminothieno[3,2-d][1,3]thiazin-4-one |
| PubChem CID | 10631349 |
| Molecular Formula | C6H4N2OS2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 2-aminothieno[3,2-d][1,3]thiazin-4-one |
| SMILES | Nc1nc2ccsc2c(=O)s1 |
| InChI | InChI=1S/C6H4N2OS2/c7-6-8-3-1-2-10-4(3)5(9)11-6/h1-2H,(H2,7,8) |
| InChIKey | HBBKPKSSOOZDJJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminothieno[3,2-d][1,3]thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminothieno[3,2-d][1,3]thiazin-4-one?
The IUPAC name of 2-aminothieno[3,2-d][1,3]thiazin-4-one (CID 10631349) is 2-aminothieno[3,2-d][1,3]thiazin-4-one.
What is the SMILES notation for 2-aminothieno[3,2-d][1,3]thiazin-4-one?
The canonical SMILES for 2-aminothieno[3,2-d][1,3]thiazin-4-one is Nc1nc2ccsc2c(=O)s1.
What is the InChIKey of 2-aminothieno[3,2-d][1,3]thiazin-4-one?
The InChIKey is HBBKPKSSOOZDJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OS2/c7-6-8-3-1-2-10-4(3)5(9)11-6/h1-2H,(H2,7,8).
What are the key properties of 2-aminothieno[3,2-d][1,3]thiazin-4-one?
2-aminothieno[3,2-d][1,3]thiazin-4-one has a molecular weight of 184.25 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminothieno[3,2-d][1,3]thiazin-4-one is sourced from PubChem (CID 10631349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).