About 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine
2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine (PubChem CID 10631427) has the molecular formula C9H22N4
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine |
| PubChem CID | 10631427 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine |
| SMILES | NCCN1CCCN(CCN)CC1 |
| InChI | InChI=1S/C9H22N4/c10-2-6-12-4-1-5-13(7-3-11)9-8-12/h1-11H2 |
| InChIKey | SWMOAYOVEKTFLC-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine?
The IUPAC name of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine (CID 10631427) is 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine.
What is the SMILES notation for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine?
The canonical SMILES for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine is NCCN1CCCN(CCN)CC1.
What is the InChIKey of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine?
The InChIKey is SWMOAYOVEKTFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N4/c10-2-6-12-4-1-5-13(7-3-11)9-8-12/h1-11H2.
What are the key properties of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine?
2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine has a molecular weight of 186.30 g/mol, XLogP of -1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]ethanamine is sourced from PubChem (CID 10631427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).