About 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide
4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide (PubChem CID 106314301) has the molecular formula C6H7ClF3N3O3S
and a molecular weight of 293.65 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide |
| PubChem CID | 106314301 |
| Molecular Formula | C6H7ClF3N3O3S |
| Molecular Weight | 293.65 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C6H7ClF3N3O3S/c1-13-5(4(7)2-11-13)17(14,15)12-16-3-6(8,9)10/h2,12H,3H2,1H3 |
| InChIKey | DGPJQHPIMFUEAL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide?
The IUPAC name of 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide (CID 106314301) is 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide.
What is the SMILES notation for 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide?
The canonical SMILES for 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide is Cn1ncc(Cl)c1S(=O)(=O)NOCC(F)(F)F.
What is the InChIKey of 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide?
The InChIKey is DGPJQHPIMFUEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClF3N3O3S/c1-13-5(4(7)2-11-13)17(14,15)12-16-3-6(8,9)10/h2,12H,3H2,1H3.
What are the key properties of 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide?
4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide has a molecular weight of 293.65 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methyl-N-(2,2,2-trifluoroethoxy)pyrazole-5-sulfonamide is sourced from PubChem (CID 106314301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).