C14H16BrNO — CID 106314340
(4-bromo-3-methylphenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 106314340) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-bromo-3-methylphenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 106314340 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (4-bromo-3-methylphenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC1=CCCN(C(=O)c2ccc(Br)c(C)c2)C1 |
| InChI | InChI=1S/C14H16BrNO/c1-10-4-3-7-16(9-10)14(17)12-5-6-13(15)11(2)8-12/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | ZBAPPUWCHALDIK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|