About 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine
3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine (PubChem CID 106314849) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine.
Molecular Properties
| Compound Name | 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine |
| PubChem CID | 106314849 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine |
| SMILES | CC1=CCCN(CC2CSCCN2)C1 |
| InChI | InChI=1S/C11H20N2S/c1-10-3-2-5-13(7-10)8-11-9-14-6-4-12-11/h3,11-12H,2,4-9H2,1H3 |
| InChIKey | BHWWHRJFAOAQBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine?
The IUPAC name of 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine (CID 106314849) is 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine.
What is the SMILES notation for 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine?
The canonical SMILES for 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine is CC1=CCCN(CC2CSCCN2)C1.
What is the InChIKey of 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine?
The InChIKey is BHWWHRJFAOAQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-10-3-2-5-13(7-10)8-11-9-14-6-4-12-11/h3,11-12H,2,4-9H2,1H3.
What are the key properties of 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine?
3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine has a molecular weight of 212.36 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]thiomorpholine is sourced from PubChem (CID 106314849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).