C11H22N2 — CID 106315016
N,2-dimethyl-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine (PubChem CID 106315016) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N,2-dimethyl-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine.
| Compound Name | N,2-dimethyl-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 106315016 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N,2-dimethyl-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine |
| SMILES | CNCC(C)CN1CCC=C(C)C1 |
| InChI | InChI=1S/C11H22N2/c1-10-5-4-6-13(8-10)9-11(2)7-12-3/h5,11-12H,4,6-9H2,1-3H3 |
| InChIKey | BWQHIPUUPSLKJA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|