C8H13ClN4O2S — CID 106315126
N-(3-aminocyclobutyl)-4-chloro-1-methylpyrazole-5-sulfonamide (PubChem CID 106315126) has the molecular formula C8H13ClN4O2S and a molecular weight of 264.74 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-4-chloro-1-methylpyrazole-5-sulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106315126 |
| Molecular Formula | C8H13ClN4O2S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-(3-aminocyclobutyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NC1CC(N)C1 |
| InChI | InChI=1S/C8H13ClN4O2S/c1-13-8(7(9)4-11-13)16(14,15)12-6-2-5(10)3-6/h4-6,12H,2-3,10H2,1H3 |
| InChIKey | MAWVBUKBYBYEAM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |