C13H14FNO — CID 106315144
3-fluoro-5-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde (PubChem CID 106315144) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-fluoro-5-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde.
| Compound Name | 3-fluoro-5-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 106315144 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-fluoro-5-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde |
| SMILES | CC1=CCCN(c2cc(F)cc(C=O)c2)C1 |
| InChI | InChI=1S/C13H14FNO/c1-10-3-2-4-15(8-10)13-6-11(9-16)5-12(14)7-13/h3,5-7,9H,2,4,8H2,1H3 |
| InChIKey | COWYXWVUHPLPNE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|