About 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde
2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde (PubChem CID 106315177) has the molecular formula C13H14BrNO
and a molecular weight of 280.17 g/mol. Its IUPAC name is 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde |
| PubChem CID | 106315177 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde |
| SMILES | CC1=CCCN(c2ccc(C=O)c(Br)c2)C1 |
| InChI | InChI=1S/C13H14BrNO/c1-10-3-2-6-15(8-10)12-5-4-11(9-16)13(14)7-12/h3-5,7,9H,2,6,8H2,1H3 |
| InChIKey | HPVZIPRTLRVUFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde?
The IUPAC name of 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde (CID 106315177) is 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde.
What is the SMILES notation for 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde?
The canonical SMILES for 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde is CC1=CCCN(c2ccc(C=O)c(Br)c2)C1.
What is the InChIKey of 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde?
The InChIKey is HPVZIPRTLRVUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO/c1-10-3-2-6-15(8-10)12-5-4-11(9-16)13(14)7-12/h3-5,7,9H,2,6,8H2,1H3.
What are the key properties of 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde?
2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde has a molecular weight of 280.17 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzaldehyde is sourced from PubChem (CID 106315177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).