C13H21ClN4O2S — CID 106315252
1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-pyrrolidin-2-ylpiperidine (PubChem CID 106315252) has the molecular formula C13H21ClN4O2S and a molecular weight of 332.86 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 106315252 |
| Molecular Formula | C13H21ClN4O2S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C13H21ClN4O2S/c1-17-13(11(14)9-16-17)21(19,20)18-7-4-10(5-8-18)12-3-2-6-15-12/h9-10,12,15H,2-8H2,1H3 |
| InChIKey | KXFLKFMWGOGHFZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |