C15H24N2O3 — CID 106315949
1-[[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 106315949) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106315949 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1=CCCN(C(=O)NCC2(C(=O)O)CCCCC2)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-12-6-5-9-17(10-12)14(20)16-11-15(13(18)19)7-3-2-4-8-15/h6H,2-5,7-11H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | KGSNOXILKBEIEO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|