About 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid
4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid (PubChem CID 106315997) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid |
| PubChem CID | 106315997 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid |
| SMILES | CC1=CCCN(C(=O)N(CCCC(=O)O)C(C)C)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-11(2)16(9-5-7-13(17)18)14(19)15-8-4-6-12(3)10-15/h6,11H,4-5,7-10H2,1-3H3,(H,17,18) |
| InChIKey | YYKPHYHDEHJFMW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid?
The IUPAC name of 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid (CID 106315997) is 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid.
What is the SMILES notation for 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid?
The canonical SMILES for 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid is CC1=CCCN(C(=O)N(CCCC(=O)O)C(C)C)C1.
What is the InChIKey of 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid?
The InChIKey is YYKPHYHDEHJFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-11(2)16(9-5-7-13(17)18)14(19)15-8-4-6-12(3)10-15/h6,11H,4-5,7-10H2,1-3H3,(H,17,18).
What are the key properties of 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid?
4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid has a molecular weight of 268.36 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-propan-2-ylamino]butanoic acid is sourced from PubChem (CID 106315997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).