About ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate
ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate (PubChem CID 106316272) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate |
| PubChem CID | 106316272 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCC=C(C)C1 |
| InChI | InChI=1S/C10H15NO3/c1-3-14-10(13)9(12)11-6-4-5-8(2)7-11/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | DIWCVZALFPEQBE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate?
The IUPAC name of ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate (CID 106316272) is ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate.
What is the SMILES notation for ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate?
The canonical SMILES for ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate is CCOC(=O)C(=O)N1CCC=C(C)C1.
What is the InChIKey of ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate?
The InChIKey is DIWCVZALFPEQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-3-14-10(13)9(12)11-6-4-5-8(2)7-11/h5H,3-4,6-7H2,1-2H3.
What are the key properties of ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate?
ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate has a molecular weight of 197.23 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-oxoacetate is sourced from PubChem (CID 106316272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).