About 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol
1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol (PubChem CID 10631655) has the molecular formula C9H13F3O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol |
| PubChem CID | 10631655 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol |
| SMILES | OC(C(F)=C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C9H13F3O/c10-7(9(11)12)8(13)6-4-2-1-3-5-6/h6,8,13H,1-5H2 |
| InChIKey | LQAOTNVIMIPDSC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol?
The IUPAC name of 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol (CID 10631655) is 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol.
What is the SMILES notation for 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol?
The canonical SMILES for 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol is OC(C(F)=C(F)F)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol?
The InChIKey is LQAOTNVIMIPDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O/c10-7(9(11)12)8(13)6-4-2-1-3-5-6/h6,8,13H,1-5H2.
What are the key properties of 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol?
1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol has a molecular weight of 194.20 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,3,3-trifluoroprop-2-en-1-ol is sourced from PubChem (CID 10631655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).