C9H15NO — CID 106316937
1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one (PubChem CID 106316937) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one.
| Compound Name | 1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 106316937 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
| SMILES | CCC(=O)N1CCC=C(C)C1 |
| InChI | InChI=1S/C9H15NO/c1-3-9(11)10-6-4-5-8(2)7-10/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | PVRWEAMOSFQDNT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|