About N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine
N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine (PubChem CID 106317148) has the molecular formula C15H29N3O2S
and a molecular weight of 315.48 g/mol. Its IUPAC name is N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine |
| PubChem CID | 106317148 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine |
| SMILES | CC1=CCCN(S(=O)(=O)N2CCCCC2CNC(C)C)C1 |
| InChI | InChI=1S/C15H29N3O2S/c1-13(2)16-11-15-8-4-5-10-18(15)21(19,20)17-9-6-7-14(3)12-17/h7,13,15-16H,4-6,8-12H2,1-3H3 |
| InChIKey | VNWXXVGIQJNHAQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine?
The IUPAC name of N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine (CID 106317148) is N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine is CC1=CCCN(S(=O)(=O)N2CCCCC2CNC(C)C)C1.
What is the InChIKey of N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine?
The InChIKey is VNWXXVGIQJNHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O2S/c1-13(2)16-11-15-8-4-5-10-18(15)21(19,20)17-9-6-7-14(3)12-17/h7,13,15-16H,4-6,8-12H2,1-3H3.
What are the key properties of N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine?
N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine has a molecular weight of 315.48 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperidin-2-yl]methyl]propan-2-amine is sourced from PubChem (CID 106317148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).