About (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea
(3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea (PubChem CID 10631917) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea.
Molecular Properties
| Compound Name | (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea |
| PubChem CID | 10631917 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea |
| SMILES | CN(C)C(=S)/N=C/N1CCOCC1 |
| InChI | InChI=1S/C8H15N3OS/c1-10(2)8(13)9-7-11-3-5-12-6-4-11/h7H,3-6H2,1-2H3/b9-7+ |
| InChIKey | UURJBDFUMRASNB-VQHVLOKHSA-N |
| XLogP | 0.19 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea?
The IUPAC name of (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea (CID 10631917) is (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea.
What is the SMILES notation for (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea?
The canonical SMILES for (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea is CN(C)C(=S)/N=C/N1CCOCC1.
What is the InChIKey of (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea?
The InChIKey is UURJBDFUMRASNB-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-10(2)8(13)9-7-11-3-5-12-6-4-11/h7H,3-6H2,1-2H3/b9-7+.
What are the key properties of (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea?
(3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea has a molecular weight of 201.29 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1,1-dimethyl-3-(morpholin-4-ylmethylidene)thiourea is sourced from PubChem (CID 10631917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).