C7H4Cl2N2O — CID 10631965
5,6-dichloro-1,3-dihydropyrrolo[3,2-b]pyridin-2-one (PubChem CID 10631965) has the molecular formula C7H4Cl2N2O and a molecular weight of 203.03 g/mol. Its IUPAC name is 5,6-dichloro-1,3-dihydropyrrolo[3,2-b]pyridin-2-one.
| Compound Name | 5,6-dichloro-1,3-dihydropyrrolo[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 10631965 |
| Molecular Formula | C7H4Cl2N2O |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.97 |
| IUPAC Name | 5,6-dichloro-1,3-dihydropyrrolo[3,2-b]pyridin-2-one |
| SMILES | O=C1Cc2nc(Cl)c(Cl)cc2N1 |
| InChI | InChI=1S/C7H4Cl2N2O/c8-3-1-4-5(11-7(3)9)2-6(12)10-4/h1H,2H2,(H,10,12) |
| InChIKey | WBELRPLQLMBTCK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|