About 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide
1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106321009) has the molecular formula C13H15ClN4OS
and a molecular weight of 310.81 g/mol. Its IUPAC name is 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide |
| PubChem CID | 106321009 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(c2nc(Cl)nc3sccc23)C1 |
| InChI | InChI=1S/C13H15ClN4OS/c1-13(11(19)15-2)4-5-18(7-13)9-8-3-6-20-10(8)17-12(14)16-9/h3,6H,4-5,7H2,1-2H3,(H,15,19) |
| InChIKey | GKEIJYRZEGLDGG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide?
The IUPAC name of 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide (CID 106321009) is 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide.
What is the SMILES notation for 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide?
The canonical SMILES for 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide is CNC(=O)C1(C)CCN(c2nc(Cl)nc3sccc23)C1.
What is the InChIKey of 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide?
The InChIKey is GKEIJYRZEGLDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN4OS/c1-13(11(19)15-2)4-5-18(7-13)9-8-3-6-20-10(8)17-12(14)16-9/h3,6H,4-5,7H2,1-2H3,(H,15,19).
What are the key properties of 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide?
1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide has a molecular weight of 310.81 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-N,3-dimethylpyrrolidine-3-carboxamide is sourced from PubChem (CID 106321009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).