C14H25N — CID 10632144
(5R,8aS)-5-hexyl-1,2,3,5,8,8a-hexahydroindolizine (PubChem CID 10632144) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (5R,8aS)-5-hexyl-1,2,3,5,8,8a-hexahydroindolizine.
| Compound Name | (5R,8aS)-5-hexyl-1,2,3,5,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 10632144 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (5R,8aS)-5-hexyl-1,2,3,5,8,8a-hexahydroindolizine |
| SMILES | CCCCCC[C@@H]1C=CC[C@@H]2CCCN21 |
| InChI | InChI=1S/C14H25N/c1-2-3-4-5-8-13-9-6-10-14-11-7-12-15(13)14/h6,9,13-14H,2-5,7-8,10-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | NAFYCXQMSOHLCL-ZIAGYGMSSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|