C13H16N2O3 — CID 106321479
cis-(1R,3S)-3-(phenylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 106321479) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is cis-(1R,3S)-3-(phenylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(phenylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106321479 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | cis-(1R,3S)-3-(phenylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(Nc1ccccc1)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(17)9-6-7-11(8-9)15-13(18)14-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,16,17)(H2,14,15,18)/t9-,11+/m1/s1 |
| InChIKey | XXHLQDAMJDZOHI-KOLCDFICSA-N |
| XLogP | 2.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |