About methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate
methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate (PubChem CID 10632235) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate |
| PubChem CID | 10632235 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate |
| SMILES | C=C(NC(=O)c1coc(C)n1)C(=O)OC |
| InChI | InChI=1S/C9H10N2O4/c1-5(9(13)14-3)10-8(12)7-4-15-6(2)11-7/h4H,1H2,2-3H3,(H,10,12) |
| InChIKey | POSDLZALRCVOQA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate?
The IUPAC name of methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate (CID 10632235) is methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate.
What is the SMILES notation for methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate?
The canonical SMILES for methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate is C=C(NC(=O)c1coc(C)n1)C(=O)OC.
What is the InChIKey of methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate?
The InChIKey is POSDLZALRCVOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c1-5(9(13)14-3)10-8(12)7-4-15-6(2)11-7/h4H,1H2,2-3H3,(H,10,12).
What are the key properties of methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate?
methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate has a molecular weight of 210.19 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-methyl-1,3-oxazole-4-carbonyl)amino]prop-2-enoate is sourced from PubChem (CID 10632235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).