C10H12O5 — CID 10632374
1-[(1S,2R,3S,4S,6R,7R)-4-deuteriocarbonyl-8,9,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]ethanone (PubChem CID 10632374) has the molecular formula C10H12O5 and a molecular weight of 213.21 g/mol. Its IUPAC name is 1-[(1S,2R,3S,4S,6R,7R)-4-deuteriocarbonyl-8,9,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]ethanone.
| Compound Name | 1-[(1S,2R,3S,4S,6R,7R)-4-deuteriocarbonyl-8,9,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]ethanone |
|---|---|
| PubChem CID | 10632374 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-[(1S,2R,3S,4S,6R,7R)-4-deuteriocarbonyl-8,9,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]ethanone |
| SMILES | [2H]C(=O)[C@H]1C[C@H]2[C@H]3OO[C@H](O3)[C@H]2[C@H]1C(C)=O |
| InChI | InChI=1S/C10H12O5/c1-4(12)7-5(3-11)2-6-8(7)10-13-9(6)14-15-10/h3,5-10H,2H2,1H3/t5-,6-,7+,8-,9-,10+/m1/s1/i3D |
| InChIKey | GWWPRKACQDRKPL-ULFCZSBBSA-N |
| XLogP | 0.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|