C15H26FNOSi — CID 106323752
2-(4-fluorophenyl)-N-(2-methoxyethyl)-3-trimethylsilylpropan-1-amine (PubChem CID 106323752) has the molecular formula C15H26FNOSi and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(2-methoxyethyl)-3-trimethylsilylpropan-1-amine.
| Compound Name | 2-(4-fluorophenyl)-N-(2-methoxyethyl)-3-trimethylsilylpropan-1-amine |
|---|---|
| PubChem CID | 106323752 |
| Molecular Formula | C15H26FNOSi |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(2-methoxyethyl)-3-trimethylsilylpropan-1-amine |
| SMILES | COCCNCC(C[Si](C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H26FNOSi/c1-18-10-9-17-11-14(12-19(2,3)4)13-5-7-15(16)8-6-13/h5-8,14,17H,9-12H2,1-4H3 |
| InChIKey | GKTIODCEPCDFRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|