C13H13NO2 — CID 10632455
(4S)-4-[(2S,3R)-3-ethenyloxiran-2-yl]-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 10632455) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4S)-4-[(2S,3R)-3-ethenyloxiran-2-yl]-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-[(2S,3R)-3-ethenyloxiran-2-yl]-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10632455 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (4S)-4-[(2S,3R)-3-ethenyloxiran-2-yl]-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C=C[C@H]1O[C@H]1[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C13H13NO2/c1-2-11-12(16-11)10-8-15-13(14-10)9-6-4-3-5-7-9/h2-7,10-12H,1,8H2/t10-,11+,12-/m0/s1 |
| InChIKey | JURBRWJVXGWKML-TUAOUCFPSA-N |
| XLogP | 1.79 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|