C12H18N4O2S — CID 106324866
4-nitro-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine (PubChem CID 106324866) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-nitro-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine.
| Compound Name | 4-nitro-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106324866 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-nitro-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1NCCN1CCSCC1 |
| InChI | InChI=1S/C12H18N4O2S/c13-11-9-10(16(17)18)1-2-12(11)14-3-4-15-5-7-19-8-6-15/h1-2,9,14H,3-8,13H2 |
| InChIKey | HTEKYRTUKCPICT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|