C9H20N2O2S — CID 106325271
3-(2-thiomorpholin-4-ylethylamino)propane-1,2-diol (PubChem CID 106325271) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 3-(2-thiomorpholin-4-ylethylamino)propane-1,2-diol.
| Compound Name | 3-(2-thiomorpholin-4-ylethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 106325271 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(2-thiomorpholin-4-ylethylamino)propane-1,2-diol |
| SMILES | OCC(O)CNCCN1CCSCC1 |
| InChI | InChI=1S/C9H20N2O2S/c12-8-9(13)7-10-1-2-11-3-5-14-6-4-11/h9-10,12-13H,1-8H2 |
| InChIKey | HDNLSNCCNUMCCE-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|