C11H17ClO2 — CID 10632545
[(1R,4R)-4-chlorocyclohex-2-en-1-yl] 2,2-dimethylpropanoate (PubChem CID 10632545) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is [(1R,4R)-4-chlorocyclohex-2-en-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,4R)-4-chlorocyclohex-2-en-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10632545 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | [(1R,4R)-4-chlorocyclohex-2-en-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=C[C@H](Cl)CC1 |
| InChI | InChI=1S/C11H17ClO2/c1-11(2,3)10(13)14-9-6-4-8(12)5-7-9/h4,6,8-9H,5,7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | WAHROFCIVFNPSR-IUCAKERBSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|