C12H19N3S — CID 106325916
3-methyl-N-(2-thiomorpholin-4-ylethyl)pyridin-2-amine (PubChem CID 106325916) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-methyl-N-(2-thiomorpholin-4-ylethyl)pyridin-2-amine.
| Compound Name | 3-methyl-N-(2-thiomorpholin-4-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106325916 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-methyl-N-(2-thiomorpholin-4-ylethyl)pyridin-2-amine |
| SMILES | Cc1cccnc1NCCN1CCSCC1 |
| InChI | InChI=1S/C12H19N3S/c1-11-3-2-4-13-12(11)14-5-6-15-7-9-16-10-8-15/h2-4H,5-10H2,1H3,(H,13,14) |
| InChIKey | DLDUDHWOAJOEBS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |