About 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione
3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione (PubChem CID 106326374) has the molecular formula C12H21N3O2S
and a molecular weight of 271.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione |
| PubChem CID | 106326374 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione |
| SMILES | CC1(C)NC(=O)CN(CCN2CCSCC2)C1=O |
| InChI | InChI=1S/C12H21N3O2S/c1-12(2)11(17)15(9-10(16)13-12)4-3-14-5-7-18-8-6-14/h3-9H2,1-2H3,(H,13,16) |
| InChIKey | XVRZMWOMKKWDBC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione?
The IUPAC name of 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione (CID 106326374) is 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione.
What is the SMILES notation for 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione?
The canonical SMILES for 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione is CC1(C)NC(=O)CN(CCN2CCSCC2)C1=O.
What is the InChIKey of 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione?
The InChIKey is XVRZMWOMKKWDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S/c1-12(2)11(17)15(9-10(16)13-12)4-3-14-5-7-18-8-6-14/h3-9H2,1-2H3,(H,13,16).
What are the key properties of 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione?
3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione has a molecular weight of 271.39 g/mol, XLogP of -0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-thiomorpholin-4-ylethyl)piperazine-2,5-dione is sourced from PubChem (CID 106326374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).