About (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline
(3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline (PubChem CID 10632686) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 10632686 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline |
| SMILES | CCC[C@@H]1CN(C)c2ccccc2[C@H]1OC |
| InChI | InChI=1S/C14H21NO/c1-4-7-11-10-15(2)13-9-6-5-8-12(13)14(11)16-3/h5-6,8-9,11,14H,4,7,10H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | VKNOTSOPSPHQBI-RISCZKNCSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline?
The IUPAC name of (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline (CID 10632686) is (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline is CCC[C@@H]1CN(C)c2ccccc2[C@H]1OC.
What is the InChIKey of (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline?
The InChIKey is VKNOTSOPSPHQBI-RISCZKNCSA-N. The full InChI is InChI=1S/C14H21NO/c1-4-7-11-10-15(2)13-9-6-5-8-12(13)14(11)16-3/h5-6,8-9,11,14H,4,7,10H2,1-3H3/t11-,14+/m1/s1.
What are the key properties of (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline?
(3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline has a molecular weight of 219.33 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-methoxy-1-methyl-3-propyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 10632686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).