C14H23N5OS — CID 106327211
2-ethyl-6-hydrazinyl-N-(2-thiomorpholin-4-ylethyl)pyridine-4-carboxamide (PubChem CID 106327211) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-ethyl-6-hydrazinyl-N-(2-thiomorpholin-4-ylethyl)pyridine-4-carboxamide.
| Compound Name | 2-ethyl-6-hydrazinyl-N-(2-thiomorpholin-4-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106327211 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-ethyl-6-hydrazinyl-N-(2-thiomorpholin-4-ylethyl)pyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)NCCN2CCSCC2)cc(NN)n1 |
| InChI | InChI=1S/C14H23N5OS/c1-2-12-9-11(10-13(17-12)18-15)14(20)16-3-4-19-5-7-21-8-6-19/h9-10H,2-8,15H2,1H3,(H,16,20)(H,17,18) |
| InChIKey | ZVPHRVCTWCVFLC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|