C13H16OS — CID 10632742
1-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanyl-2-methylbenzene (PubChem CID 10632742) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanyl-2-methylbenzene.
| Compound Name | 1-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanyl-2-methylbenzene |
|---|---|
| PubChem CID | 10632742 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanyl-2-methylbenzene |
| SMILES | CO/C=C/C(C)=C/Sc1ccccc1C |
| InChI | InChI=1S/C13H16OS/c1-11(8-9-14-3)10-15-13-7-5-4-6-12(13)2/h4-10H,1-3H3/b9-8+,11-10+ |
| InChIKey | ZNSBBOVXDIXFAB-BNFZFUHLSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|